CAS 6848-19-7 appears in our catalog under these names: 2,2,4,8-Tetramethyl-1,2-dihydroquinoline, 95%, 2,2,4,8-Tetramethyl-1,2-dihydroquinoline 98%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 250mg, 5g, 1g, 100mg.
2,2,4,8-tetramethyl-1H-quinoline (CAS 6848-19-7) is a chemical compound with the molecular formula C13H17N and a molecular weight of 187.28 g/mol. IUPAC name: 2,2,4,8-tetramethyl-1H-quinoline. InChIKey: IDFVSRHOUFJATJ-UHFFFAOYSA-N.
| Molecular formula | C13H17N |
|---|---|
| Molecular weight | 187.28 g/mol |
| IUPAC name | 2,2,4,8-tetramethyl-1H-quinoline |
| InChIKey | IDFVSRHOUFJATJ-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)C(=CC(N2)(C)C)C |
Computed by PubChem (NCBI)