Products 88166-76-1
CAS 88166-76-1 appears in our catalog under these names: 4-tert-Butyl-2,6-dimethylbenzonitrile, 95%, 4-tert-Butyl-2,6-dimethylbenzonitrile. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 2000mg, 1000mg.
4-tert-butyl-2,6-dimethylbenzonitrile (CAS 88166-76-1) is a chemical compound with the molecular formula C13H17N and a molecular weight of 187.28 g/mol. IUPAC name: 4-tert-butyl-2,6-dimethylbenzonitrile. InChIKey: OIOQMLCBUREXCF-UHFFFAOYSA-N.
| Molecular formula | C13H17N |
|---|---|
| Molecular weight | 187.28 g/mol |
| IUPAC name | 4-tert-butyl-2,6-dimethylbenzonitrile |
| InChIKey | OIOQMLCBUREXCF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1C#N)C)C(C)(C)C |
Computed by PubChem (NCBI)