CAS 68559-48-8 is the registry number for 5-(2-Chlorobenzoyl)-4,5,6,7-tetrahydrothieno(3,2-c)pyridine. Offered by: Mikromol. Available pack sizes: 25mg, 100mg.
(2-chlorophenyl)-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)methanone (CAS 68559-48-8) is a chemical compound with the molecular formula C14H12ClNOS and a molecular weight of 277.8 g/mol. IUPAC name: (2-chlorophenyl)-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)methanone. InChIKey: ARHVQOBKFAPHQP-UHFFFAOYSA-N.
| Molecular formula | C14H12ClNOS |
|---|---|
| Molecular weight | 277.8 g/mol |
| IUPAC name | (2-chlorophenyl)-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)methanone |
| InChIKey | ARHVQOBKFAPHQP-UHFFFAOYSA-N |
| SMILES | C1CN(CC2=C1SC=C2)C(=O)C3=CC=CC=C3Cl |
Computed by PubChem (NCBI)