Products 68597-44-4
CAS 68597-44-4 is the registry number for 1-(5-Chloro-2-methoxyphenyl)propan-1-one. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
1-(5-chloro-2-methoxyphenyl)propan-1-one (CAS 68597-44-4) is a chemical compound with the molecular formula C10H11ClO2 and a molecular weight of 198.64 g/mol. IUPAC name: 1-(5-chloro-2-methoxyphenyl)propan-1-one. InChIKey: UAXKJHNDCLNPES-UHFFFAOYSA-N.
| Molecular formula | C10H11ClO2 |
|---|---|
| Molecular weight | 198.64 g/mol |
| IUPAC name | 1-(5-chloro-2-methoxyphenyl)propan-1-one |
| InChIKey | UAXKJHNDCLNPES-UHFFFAOYSA-N |
| SMILES | CCC(=O)C1=C(C=CC(=C1)Cl)OC |
Computed by PubChem (NCBI)