CAS 68621-59-0 appears in our catalog under these names: Phenyl n-(3-aminophenyl)carbamate, 95%, Phenyl N-(3-aminophenyl)carbamate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 10g.
Phenyl N-(3-aminophenyl)carbamate (CAS 68621-59-0) is a chemical compound with the molecular formula C13H12N2O2 and a molecular weight of 228.25 g/mol. IUPAC name: phenyl N-(3-aminophenyl)carbamate. InChIKey: IXRLLLRWRZSZLT-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O2 |
|---|---|
| Molecular weight | 228.25 g/mol |
| IUPAC name | phenyl N-(3-aminophenyl)carbamate |
| InChIKey | IXRLLLRWRZSZLT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC(=O)NC2=CC=CC(=C2)N |
Computed by PubChem (NCBI)