Products 686347-59-1
CAS 686347-59-1 is the registry number for 1-Benzhydryl-3-hydroxyazetidine-3-carbonitrile, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
1-benzhydryl-3-hydroxyazetidine-3-carbonitrile (CAS 686347-59-1) is a chemical compound with the molecular formula C17H16N2O and a molecular weight of 264.32 g/mol. IUPAC name: 1-benzhydryl-3-hydroxyazetidine-3-carbonitrile. InChIKey: OOGDXRGLXBOXIY-UHFFFAOYSA-N.
| Molecular formula | C17H16N2O |
|---|---|
| Molecular weight | 264.32 g/mol |
| IUPAC name | 1-benzhydryl-3-hydroxyazetidine-3-carbonitrile |
| InChIKey | OOGDXRGLXBOXIY-UHFFFAOYSA-N |
| SMILES | C1C(CN1C(C2=CC=CC=C2)C3=CC=CC=C3)(C#N)O |
Computed by PubChem (NCBI)