CAS 68707-69-7 appears in our catalog under these names: 2,3-Dimethyl-4-nitropyridine, 95%, 2,3-Dimethyl-4-nitropyridine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 100mg.
2,3-dimethyl-4-nitropyridine (CAS 68707-69-7) is a chemical compound with the molecular formula C7H8N2O2 and a molecular weight of 152.15 g/mol. IUPAC name: 2,3-dimethyl-4-nitropyridine. InChIKey: WSQGOUOZNCRFNQ-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O2 |
|---|---|
| Molecular weight | 152.15 g/mol |
| IUPAC name | 2,3-dimethyl-4-nitropyridine |
| InChIKey | WSQGOUOZNCRFNQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CN=C1C)[N+](=O)[O-] |
Computed by PubChem (NCBI)