CAS 6872-05-5 is the registry number for 5-Amino-2-methylene-1,3,3-trimethylindoline. Offered by: TRC. Available pack sizes: 100mg, 250mg, 500mg.
1,3,3-trimethyl-2-methylideneindol-5-amine (CAS 6872-05-5) is a chemical compound with the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. IUPAC name: 1,3,3-trimethyl-2-methylideneindol-5-amine. InChIKey: WHPVQSTYFPPYCQ-UHFFFAOYSA-N.
| Molecular formula | C12H16N2 |
|---|---|
| Molecular weight | 188.27 g/mol |
| IUPAC name | 1,3,3-trimethyl-2-methylideneindol-5-amine |
| InChIKey | WHPVQSTYFPPYCQ-UHFFFAOYSA-N |
| SMILES | CC1(C(=C)N(C2=C1C=C(C=C2)N)C)C |
Computed by PubChem (NCBI)