Products 68787-64-4
CAS 68787-64-4 is the registry number for Methyl 2-Allyl-3-hydroxy-5-methoxybenzoate, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
Methyl 3-hydroxy-5-methoxy-2-prop-2-enylbenzoate (CAS 68787-64-4) is a chemical compound with the molecular formula C12H14O4 and a molecular weight of 222.24 g/mol. IUPAC name: methyl 3-hydroxy-5-methoxy-2-prop-2-enylbenzoate. InChIKey: UCKQNVAODWYVBD-UHFFFAOYSA-N.
| Molecular formula | C12H14O4 |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | methyl 3-hydroxy-5-methoxy-2-prop-2-enylbenzoate |
| InChIKey | UCKQNVAODWYVBD-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1)O)CC=C)C(=O)OC |
Computed by PubChem (NCBI)