Products 6879-02-3
CAS 6879-02-3 is the registry number for Tylocrebrine. Offered by: MedChemExpress. Available pack sizes: Get quote.
(13aR)-2,3,5,6-tetramethoxy-9,11,12,13,13a,14-hexahydrophenanthro[9,10-f]indolizine (CAS 6879-02-3) is a chemical compound with the molecular formula C24H27NO4 and a molecular weight of 393.5 g/mol. IUPAC name: (13aR)-2,3,5,6-tetramethoxy-9,11,12,13,13a,14-hexahydrophenanthro[9,10-f]indolizine. InChIKey: YFEPHJVWLFGWKH-CQSZACIVSA-N.
| Molecular formula | C24H27NO4 |
|---|---|
| Molecular weight | 393.5 g/mol |
| IUPAC name | (13aR)-2,3,5,6-tetramethoxy-9,11,12,13,13a,14-hexahydrophenanthro[9,10-f]indolizine |
| InChIKey | YFEPHJVWLFGWKH-CQSZACIVSA-N |
| SMILES | COC1=C(C2=C(C=C1)C3=C(C[C@H]4CCCN4C3)C5=CC(=C(C=C52)OC)OC)OC |
Computed by PubChem (NCBI)