Products 6879-59-0
CAS 6879-59-0 is the registry number for Fumigaclavine A. Offered by: Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 1 mg, 5 mg.
[(6aR,9R,10S,10aR)-7,9-dimethyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-10-yl] acetate (CAS 6879-59-0) is a chemical compound with the molecular formula C18H22N2O2 and a molecular weight of 298.4 g/mol. IUPAC name: [(6aR,9R,10S,10aR)-7,9-dimethyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-10-yl] acetate. InChIKey: GJSSYQDXZLZOLR-ONUGHKICSA-N.
| Molecular formula | C18H22N2O2 |
|---|---|
| Molecular weight | 298.4 g/mol |
| IUPAC name | [(6aR,9R,10S,10aR)-7,9-dimethyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-10-yl] acetate |
| InChIKey | GJSSYQDXZLZOLR-ONUGHKICSA-N |
| SMILES | C[C@@H]1CN([C@@H]2CC3=CNC4=CC=CC(=C34)[C@H]2[C@H]1OC(=O)C)C |
Computed by PubChem (NCBI)