Products 688050-45-5
CAS 688050-45-5 appears in our catalog under these names: CFTR corrector 11, CFTR corrector 11, 99.80%, CFTR corrector 11, ≥98%. Offered by: GLPBio, MedChemExpress, Chemat. Available pack sizes: 5mg, 10mg, 25mg, 5 mg, 25 mg, 10 mg, 50mg, 100mg.
5-(4-methoxyphenyl)-N-(3-morpholin-4-ylpropyl)-1,2-oxazole-3-carboxamide (CAS 688050-45-5) is a chemical compound with the molecular formula C18H23N3O4 and a molecular weight of 345.4 g/mol. IUPAC name: 5-(4-methoxyphenyl)-N-(3-morpholin-4-ylpropyl)-1,2-oxazole-3-carboxamide. InChIKey: COLCDHPLJCTYQT-UHFFFAOYSA-N.
| Molecular formula | C18H23N3O4 |
|---|---|
| Molecular weight | 345.4 g/mol |
| IUPAC name | 5-(4-methoxyphenyl)-N-(3-morpholin-4-ylpropyl)-1,2-oxazole-3-carboxamide |
| InChIKey | COLCDHPLJCTYQT-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=CC(=NO2)C(=O)NCCCN3CCOCC3 |
Computed by PubChem (NCBI)