Products 688309-04-8
CAS 688309-04-8 is the registry number for 1,3-bis(2,3-dihydro-1-benzofuran-5-yl)urea, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
1,3-bis(2,3-dihydro-1-benzofuran-5-yl)urea (CAS 688309-04-8) is a chemical compound with the molecular formula C17H16N2O3 and a molecular weight of 296.32 g/mol. IUPAC name: 1,3-bis(2,3-dihydro-1-benzofuran-5-yl)urea. InChIKey: ZFDHKKSTIACNOP-UHFFFAOYSA-N.
| Molecular formula | C17H16N2O3 |
|---|---|
| Molecular weight | 296.32 g/mol |
| IUPAC name | 1,3-bis(2,3-dihydro-1-benzofuran-5-yl)urea |
| InChIKey | ZFDHKKSTIACNOP-UHFFFAOYSA-N |
| SMILES | C1COC2=C1C=C(C=C2)NC(=O)NC3=CC4=C(C=C3)OCC4 |
Computed by PubChem (NCBI)