Products 68885-32-5
CAS 68885-32-5 appears in our catalog under these names: (4-Chlorophenyl)(pyridin-3-yl)methanol, 95+%, (4-Chlorophenyl)(pyridin-3-yl)methanol. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
(4-chlorophenyl)-pyridin-3-ylmethanol (CAS 68885-32-5) is a chemical compound with the molecular formula C12H10ClNO and a molecular weight of 219.66 g/mol. IUPAC name: (4-chlorophenyl)-pyridin-3-ylmethanol. InChIKey: CQZLNPXEFGITEZ-UHFFFAOYSA-N.
| Molecular formula | C12H10ClNO |
|---|---|
| Molecular weight | 219.66 g/mol |
| IUPAC name | (4-chlorophenyl)-pyridin-3-ylmethanol |
| InChIKey | CQZLNPXEFGITEZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C(C2=CC=C(C=C2)Cl)O |
Computed by PubChem (NCBI)