Products 68922-44-1
CAS 68922-44-1 appears in our catalog under these names: i–Inositol–d6, myo-Inositol-d6, >95% (HPLC), myo-inositol d6, >95% (HPLC), myo-Inositol-1,2,3,4,5,6-d6, 98 atom % D, min 98% Chemical Purity, Myo-inositol-d6. Offered by: GLPBio, TRC, CDN, Biosynth, MedChemExpress. Available pack sizes: 1mg, 10mg, 0,1g, 0,05g, 50mg, 100mg, 10 mg, 5 mg.
1,2,3,4,5,6-hexadeuteriocyclohexane-1,2,3,4,5,6-hexol (CAS 68922-44-1) is a chemical compound with the molecular formula C6H12O6 and a molecular weight of 186.19 g/mol. IUPAC name: 1,2,3,4,5,6-hexadeuteriocyclohexane-1,2,3,4,5,6-hexol. InChIKey: CDAISMWEOUEBRE-MZWXYZOWSA-N.
| Molecular formula | C6H12O6 |
|---|---|
| Molecular weight | 186.19 g/mol |
| IUPAC name | 1,2,3,4,5,6-hexadeuteriocyclohexane-1,2,3,4,5,6-hexol |
| InChIKey | CDAISMWEOUEBRE-MZWXYZOWSA-N |
| SMILES | [2H]C1(C(C(C(C(C1([2H])O)([2H])O)([2H])O)([2H])O)([2H])O)O |
Computed by PubChem (NCBI)