CAS 68941-95-7 appears in our catalog under these names: 5-Fluorouracil-15N2, 5-Fluorouracil-15N2, 98 atom % 15N, min 98% Chemical Purity, 5-Fluorouracil-15N2, 99.0%. Offered by: TRC, AmBeed, CDN, Biosynth, MedChemExpress. Available pack sizes: 10mg, 5mg, 0,01g, 0,005g, 25mg, 50mg, 1 mg.
5-fluoro-(1,3-15N2)1H-pyrimidine-2,4-dione (CAS 68941-95-7) is a chemical compound with the molecular formula C4H3FN2O2 and a molecular weight of 132.06 g/mol. IUPAC name: 5-fluoro-(1,3-15N2)1H-pyrimidine-2,4-dione. InChIKey: GHASVSINZRGABV-AKZCFXPHSA-N.
| Molecular formula | C4H3FN2O2 |
|---|---|
| Molecular weight | 132.06 g/mol |
| IUPAC name | 5-fluoro-(1,3-15N2)1H-pyrimidine-2,4-dione |
| InChIKey | GHASVSINZRGABV-AKZCFXPHSA-N |
| SMILES | C1=C(C(=O)[15NH]C(=O)[15NH]1)F |
Computed by PubChem (NCBI)