Products 68978-02-9
CAS 68978-02-9 is the registry number for (R)-Hispaglabridin B. Offered by: MedChemExpress. Available pack sizes: Get quote.
6-[(3R)-8,8-dimethyl-3,4-dihydro-2H-pyrano[2,3-f]chromen-3-yl]-2,2-dimethylchromen-5-ol (CAS 68978-02-9) is a chemical compound with the molecular formula C25H26O4 and a molecular weight of 390.5 g/mol. IUPAC name: 6-[(3R)-8,8-dimethyl-3,4-dihydro-2H-pyrano[2,3-f]chromen-3-yl]-2,2-dimethylchromen-5-ol. InChIKey: CJUFYKORDZSOLF-INIZCTEOSA-N.
| Molecular formula | C25H26O4 |
|---|---|
| Molecular weight | 390.5 g/mol |
| IUPAC name | 6-[(3R)-8,8-dimethyl-3,4-dihydro-2H-pyrano[2,3-f]chromen-3-yl]-2,2-dimethylchromen-5-ol |
| InChIKey | CJUFYKORDZSOLF-INIZCTEOSA-N |
| SMILES | CC1(C=CC2=C(O1)C=CC(=C2O)[C@H]3CC4=C(C5=C(C=C4)OC(C=C5)(C)C)OC3)C |
Computed by PubChem (NCBI)
Synonyms:
Hispaglabridin B