CAS 775351-88-7 appears in our catalog under these names: Corylifol A/ 99.48% (existing batch purity), Corylifol A, Corylifol A, Corylifol A (Standard), (E)-3-(3-(3,7-Dimethylocta-2,6-dien-1-yl)-4-hydroxyphenyl)-7-hydroxy-4H-chromen-4-one, 99%, 99%. Offered by: TargetMol, GLPBio, Biosynth, MedChemExpress, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 2mg.
3-[3-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-hydroxyphenyl]-7-hydroxychromen-4-one (CAS 775351-88-7) is a chemical compound with the molecular formula C25H26O4 and a molecular weight of 390.5 g/mol. IUPAC name: 3-[3-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-hydroxyphenyl]-7-hydroxychromen-4-one. InChIKey: ZBHUUXLHDOUMKM-REZTVBANSA-N.
| Molecular formula | C25H26O4 |
|---|---|
| Molecular weight | 390.5 g/mol |
| IUPAC name | 3-[3-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-hydroxyphenyl]-7-hydroxychromen-4-one |
| InChIKey | ZBHUUXLHDOUMKM-REZTVBANSA-N |
| SMILES | CC(=CCC/C(=C/CC1=C(C=CC(=C1)C2=COC3=C(C2=O)C=CC(=C3)O)O)/C)C |
Computed by PubChem (NCBI)