CAS 68979-49-7 appears in our catalog under these names: rel-Di-tert-butyl ((1R,2S)-cyclopropane-1,2-diyl)dicarbamate, Carbamic acid, 1,2-cyclopropanediylbis-, bis(1,1-dimethylethyl) ester, cis-, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl N-[(1S,2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropyl]carbamate (CAS 68979-49-7) is a chemical compound with the molecular formula C13H24N2O4 and a molecular weight of 272.34 g/mol. IUPAC name: tert-butyl N-[(1S,2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropyl]carbamate. InChIKey: XEFAFUIKGFRZRK-DTORHVGOSA-N.
| Molecular formula | C13H24N2O4 |
|---|---|
| Molecular weight | 272.34 g/mol |
| IUPAC name | tert-butyl N-[(1S,2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropyl]carbamate |
| InChIKey | XEFAFUIKGFRZRK-DTORHVGOSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1C[C@@H]1NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)