CAS 690260-90-3 appears in our catalog under these names: Ethyl 2-bromo-4-chlorobenzoate, 98%, Ethyl 2–bromo–4–chlorobenzoate, Ethyl 2-bromo-4-chlorobenzoate 98%, Ethyl 2-bromo-4-chlorobenzoate, 97%, 97%, Ethyl 2-bromo-4-chlorobenzoate, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 100g, 25g, 5g, 10g.
Ethyl 2-bromo-4-chlorobenzoate (CAS 690260-90-3) is a chemical compound with the molecular formula C9H8BrClO2 and a molecular weight of 263.51 g/mol. IUPAC name: ethyl 2-bromo-4-chlorobenzoate. InChIKey: BUKXFSIXDJSOCF-UHFFFAOYSA-N.
| Molecular formula | C9H8BrClO2 |
|---|---|
| Molecular weight | 263.51 g/mol |
| IUPAC name | ethyl 2-bromo-4-chlorobenzoate |
| InChIKey | BUKXFSIXDJSOCF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=C(C=C1)Cl)Br |
Computed by PubChem (NCBI)