Products 69049-86-1

CAS 69049-86-1 is the registry number for 2-[(tert-Butylamino)carbonyl]cyclohexanecarboxylic acid, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 1g.

2-(tert-butylcarbamoyl)cyclohexane-1-carboxylic acid (CAS 69049-86-1) is a chemical compound with the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. IUPAC name: 2-(tert-butylcarbamoyl)cyclohexane-1-carboxylic acid. InChIKey: MDYLQMLQBRWTPP-UHFFFAOYSA-N.

Identity
Molecular formulaC12H21NO3
Molecular weight227.30 g/mol
IUPAC name2-(tert-butylcarbamoyl)cyclohexane-1-carboxylic acid
InChIKeyMDYLQMLQBRWTPP-UHFFFAOYSA-N
SMILESCC(C)(C)NC(=O)C1CCCCC1C(=O)O

Computed by PubChem (NCBI)