CAS 69050-89-1 appears in our catalog under these names: 2,4-Di-tert-butyl-6-chloropyrimidine, 98%, 2,4-Di-tert-butyl-6-chloropyrimidine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 10g, 50mg, 0,5g.
2,4-ditert-butyl-6-chloropyrimidine (CAS 69050-89-1) is a chemical compound with the molecular formula C12H19ClN2 and a molecular weight of 226.74 g/mol. IUPAC name: 2,4-ditert-butyl-6-chloropyrimidine. InChIKey: ICZQYZYOGQBJNA-UHFFFAOYSA-N.
| Molecular formula | C12H19ClN2 |
|---|---|
| Molecular weight | 226.74 g/mol |
| IUPAC name | 2,4-ditert-butyl-6-chloropyrimidine |
| InChIKey | ICZQYZYOGQBJNA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=NC(=N1)C(C)(C)C)Cl |
Computed by PubChem (NCBI)