CAS 690632-38-3 appears in our catalog under these names: tert-Butyl 6-bromo-4-oxospiro[chroman-2,4'-piperidine]-1'-carboxylate, 98%, tert-Butyl 6-bromo-4-oxospiro[chroman-2,4'-piperidine]-1'-carboxylate 97%, tert-Butyl 6-bromo-4-oxospiro[chroman-2,4'-piperidine]-1'-carboxylate, 97%, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 1g, 10g, 250mg, 100mg.
Tert-butyl 6-bromo-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate (CAS 690632-38-3) is a chemical compound with the molecular formula C18H22BrNO4 and a molecular weight of 396.3 g/mol. IUPAC name: tert-butyl 6-bromo-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate. InChIKey: ZUKYLVHOLKDNGX-UHFFFAOYSA-N.
| Molecular formula | C18H22BrNO4 |
|---|---|
| Molecular weight | 396.3 g/mol |
| IUPAC name | tert-butyl 6-bromo-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate |
| InChIKey | ZUKYLVHOLKDNGX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)CC(=O)C3=C(O2)C=CC(=C3)Br |
Computed by PubChem (NCBI)