CAS 936648-38-3 appears in our catalog under these names: N-Boc-7-bromo-4-oxo-3,4-dihydro-1'h-spiro[chromene-2,4'-piperidine], 95%, tert-Butyl 7-bromo-4-oxospiro(chroman-2,4'-piperidine)-1'-carboxylate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.
Tert-butyl 7-bromo-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate (CAS 936648-38-3) is a chemical compound with the molecular formula C18H22BrNO4 and a molecular weight of 396.3 g/mol. IUPAC name: tert-butyl 7-bromo-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate. InChIKey: MNQOBNLVPNTHAT-UHFFFAOYSA-N.
| Molecular formula | C18H22BrNO4 |
|---|---|
| Molecular weight | 396.3 g/mol |
| IUPAC name | tert-butyl 7-bromo-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate |
| InChIKey | MNQOBNLVPNTHAT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)CC(=O)C3=C(O2)C=C(C=C3)Br |
Computed by PubChem (NCBI)