CAS 690660-22-1 is the registry number for (S)-4-(4-Chlorophenyl)-3,3-dimethylpiperidin-4-ol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(4S)-4-(4-chlorophenyl)-3,3-dimethylpiperidin-4-ol (CAS 690660-22-1) is a chemical compound with the molecular formula C13H18ClNO and a molecular weight of 239.74 g/mol. IUPAC name: (4S)-4-(4-chlorophenyl)-3,3-dimethylpiperidin-4-ol. InChIKey: MXDBIMUDGOIXCV-ZDUSSCGKSA-N.
| Molecular formula | C13H18ClNO |
|---|---|
| Molecular weight | 239.74 g/mol |
| IUPAC name | (4S)-4-(4-chlorophenyl)-3,3-dimethylpiperidin-4-ol |
| InChIKey | MXDBIMUDGOIXCV-ZDUSSCGKSA-N |
| SMILES | CC1(CNCC[C@@]1(C2=CC=C(C=C2)Cl)O)C |
Computed by PubChem (NCBI)