Products 691-64-5
CAS 691-64-5 appears in our catalog under these names: Di–tert–butyl oxalate, Di-tert-butyl oxalate, 96%, Di-tert-butyloxalate 95%, Di-tert-butyl Oxalate, 95%, 95%, Di-tert-butyl oxalate, 95%. Offered by: GLPBio, Thermo Scientific (Acros), Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 100g, 500g, 10g, 250g, 1g.
Ditert-butyl oxalate (CAS 691-64-5) is a chemical compound with the molecular formula C10H18O4 and a molecular weight of 202.25 g/mol. IUPAC name: ditert-butyl oxalate. InChIKey: CIYGMWIAXRMHQS-UHFFFAOYSA-N.
| Molecular formula | C10H18O4 |
|---|---|
| Molecular weight | 202.25 g/mol |
| IUPAC name | ditert-butyl oxalate |
| InChIKey | CIYGMWIAXRMHQS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)
Synonyms:
Di-tert-butyl oxalate, 1,2-Bis(1,1-dimethylethyl) ethanedioate, di-tert-butyloxalate, ditert-butyl oxalate, oxalic acid di-tert-butyl ester, di-t-butyl oxalate, Ethanedioic acid, bis(1,1-dimethylethyl) ester, Bis(1,1-dimethylethyl) oxalate, Ethanedioic acid, 1,2-bis(1,1-dimethylethyl) ester, Oxalic acid bis(1,1-dimethylethyl) ester