Products 69123-64-4
CAS 69123-64-4 is the registry number for 3-(4-Chloro-2-methylphenyl)-2-(chloromethyl)-3,4-dihydroquinazolin-4-one. Offered by: Biosynth. Available pack sizes: 1000mg.
2-(chloromethyl)-3-(4-chloro-2-methylphenyl)quinazolin-4-one (CAS 69123-64-4) is a chemical compound with the molecular formula C16H12Cl2N2O and a molecular weight of 319.2 g/mol. IUPAC name: 2-(chloromethyl)-3-(4-chloro-2-methylphenyl)quinazolin-4-one. InChIKey: VZBXCRKGTDNCGQ-UHFFFAOYSA-N.
| Molecular formula | C16H12Cl2N2O |
|---|---|
| Molecular weight | 319.2 g/mol |
| IUPAC name | 2-(chloromethyl)-3-(4-chloro-2-methylphenyl)quinazolin-4-one |
| InChIKey | VZBXCRKGTDNCGQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)Cl)N2C(=NC3=CC=CC=C3C2=O)CCl |
Computed by PubChem (NCBI)