CAS 691363-12-9 is the registry number for 1-Propyl-1,2,3-benzotriazole-5-carboxylic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-propylbenzotriazole-5-carboxylic acid (CAS 691363-12-9) is a chemical compound with the molecular formula C10H11N3O2 and a molecular weight of 205.21 g/mol. IUPAC name: 1-propylbenzotriazole-5-carboxylic acid. InChIKey: JCDAFVMXCOGHRL-UHFFFAOYSA-N.
| Molecular formula | C10H11N3O2 |
|---|---|
| Molecular weight | 205.21 g/mol |
| IUPAC name | 1-propylbenzotriazole-5-carboxylic acid |
| InChIKey | JCDAFVMXCOGHRL-UHFFFAOYSA-N |
| SMILES | CCCN1C2=C(C=C(C=C2)C(=O)O)N=N1 |
Computed by PubChem (NCBI)