Products 691412-81-4
CAS 691412-81-4 is the registry number for (S)-1-(2-Chlorophenyl)-2-methylpropan-1-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S)-1-(2-chlorophenyl)-2-methylpropan-1-amine (CAS 691412-81-4) is a chemical compound with the molecular formula C10H14ClN and a molecular weight of 183.68 g/mol. IUPAC name: (1S)-1-(2-chlorophenyl)-2-methylpropan-1-amine. InChIKey: XOALSEFEPRQWJI-JTQLQIEISA-N.
| Molecular formula | C10H14ClN |
|---|---|
| Molecular weight | 183.68 g/mol |
| IUPAC name | (1S)-1-(2-chlorophenyl)-2-methylpropan-1-amine |
| InChIKey | XOALSEFEPRQWJI-JTQLQIEISA-N |
| SMILES | CC(C)[C@@H](C1=CC=CC=C1Cl)N |
Computed by PubChem (NCBI)