CAS 692058-52-9 is the registry number for (3aR,6aS)-Rel-tetrahydro-4H-1,3-dioxolo(4,5-c)pyrrole hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(3aS,6aR)-4,5,6,6a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyrrole;hydrochloride (CAS 692058-52-9) is a chemical compound with the molecular formula C5H10ClNO2 and a molecular weight of 151.59 g/mol. IUPAC name: (3aS,6aR)-4,5,6,6a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyrrole;hydrochloride. InChIKey: VRDGPSDTYIITKT-JEVYUYNZSA-N.
| Molecular formula | C5H10ClNO2 |
|---|---|
| Molecular weight | 151.59 g/mol |
| IUPAC name | (3aS,6aR)-4,5,6,6a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyrrole;hydrochloride |
| InChIKey | VRDGPSDTYIITKT-JEVYUYNZSA-N |
| SMILES | C1[C@@H]2[C@H](CN1)OCO2.Cl |
Computed by PubChem (NCBI)