CAS 69231-87-4 appears in our catalog under these names: 4-Bromo-4'-(trifluoromethyl)biphenyl, 4-Bromo-4'-(trifluoromethyl)biphenyl, 95%, 4-Bromo-4'-(trifluoromethyl)-1,1'-biphenyl, 4-Bromo-4'-(trifluoromethyl)-1,1'-biphenyl, 97%, 4-Bromo-4'-(trifluoromethyl)-1,1'-biphenyl, ≥95%, ≥95%. Offered by: TRC, Combi-blocks, Fluorochem, AmBeed, Chemat. Available pack sizes: 10g, 5g, 25g, 1g, 250mg.
1-bromo-4-[4-(trifluoromethyl)phenyl]benzene (CAS 69231-87-4) is a chemical compound with the molecular formula C13H8BrF3 and a molecular weight of 301.10 g/mol. IUPAC name: 1-bromo-4-[4-(trifluoromethyl)phenyl]benzene. InChIKey: KLTJNRREHHZLKL-UHFFFAOYSA-N.
| Molecular formula | C13H8BrF3 |
|---|---|
| Molecular weight | 301.10 g/mol |
| IUPAC name | 1-bromo-4-[4-(trifluoromethyl)phenyl]benzene |
| InChIKey | KLTJNRREHHZLKL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)Br)C(F)(F)F |
Computed by PubChem (NCBI)