CAS 876758-59-7 appears in our catalog under these names: 4-Bromo-3-(trifluoromethyl)-1,1'-biphenyl, 95%, 4-Bromo-3-(trifluoromethyl)-1,1'-biphenyl. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg.
1-bromo-4-phenyl-2-(trifluoromethyl)benzene (CAS 876758-59-7) is a chemical compound with the molecular formula C13H8BrF3 and a molecular weight of 301.10 g/mol. IUPAC name: 1-bromo-4-phenyl-2-(trifluoromethyl)benzene. InChIKey: KNRZPGXMWGSRCT-UHFFFAOYSA-N.
| Molecular formula | C13H8BrF3 |
|---|---|
| Molecular weight | 301.10 g/mol |
| IUPAC name | 1-bromo-4-phenyl-2-(trifluoromethyl)benzene |
| InChIKey | KNRZPGXMWGSRCT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=C(C=C2)Br)C(F)(F)F |
Computed by PubChem (NCBI)