Products 693287-78-4

CAS 693287-78-4 is the registry number for tert–Butyl 2–(dihydro–2H–pyran–4(3H)–ylidene)hydrazinecarboxylate. Offered by: GLPBio. Available pack sizes: 1g, 250mg, 5g.

Structural formula: {0} (CAS {1})

Tert-butyl N-(oxan-4-ylideneamino)carbamate (CAS 693287-78-4) is a chemical compound with the molecular formula C10H18N2O3 and a molecular weight of 214.26 g/mol. IUPAC name: tert-butyl N-(oxan-4-ylideneamino)carbamate. InChIKey: QOEHTHNPTMRRLP-UHFFFAOYSA-N.

Identity
Molecular formulaC10H18N2O3
Molecular weight214.26 g/mol
IUPAC nametert-butyl N-(oxan-4-ylideneamino)carbamate
InChIKeyQOEHTHNPTMRRLP-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NN=C1CCOCC1

Computed by PubChem (NCBI)