CAS 693771-79-8 appears in our catalog under these names: 5-Methyl-4h,5h,6h,7h-[1,3]thiazolo[4,5-c]pyridine-2-carboxylic acid hydrochloride, 95%, 5-Methyl-4,5,6,7-tetrahydrothiazolo[4,5-c]pyridine-2-carboxylic acid, 98%. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 250mg, 1g, on request.
5-methyl-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridine-2-carboxylic acid;hydrochloride (CAS 693771-79-8) is a chemical compound with the molecular formula C8H11ClN2O2S and a molecular weight of 234.70 g/mol. IUPAC name: 5-methyl-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridine-2-carboxylic acid;hydrochloride. InChIKey: VFBDKOWBNNXMGN-UHFFFAOYSA-N.
| Molecular formula | C8H11ClN2O2S |
|---|---|
| Molecular weight | 234.70 g/mol |
| IUPAC name | 5-methyl-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridine-2-carboxylic acid;hydrochloride |
| InChIKey | VFBDKOWBNNXMGN-UHFFFAOYSA-N |
| SMILES | CN1CCC2=C(C1)N=C(S2)C(=O)O.Cl |
Computed by PubChem (NCBI)