Products 69399-60-6
CAS 69399-60-6 appears in our catalog under these names: 3-bromo-5-nitrobenzene-1,2-diamine, 3-Bromo-5-nitrobenzene-1,2-diamine, 98%, 98%, 3-Bromo-5-nitrobenzene-1,2-diamine, 98%. Offered by: Chemat Brand, Chemat, Fluorochem. Available pack sizes: on request, 25mg, 50mg, 100mg, 250mg, 1g, 5g.
3-bromo-5-nitrobenzene-1,2-diamine (CAS 69399-60-6) is a chemical compound with the molecular formula C6H6BrN3O2 and a molecular weight of 232.03 g/mol. IUPAC name: 3-bromo-5-nitrobenzene-1,2-diamine. InChIKey: ZMIPOEDYIVSXNT-UHFFFAOYSA-N.
| Molecular formula | C6H6BrN3O2 |
|---|---|
| Molecular weight | 232.03 g/mol |
| IUPAC name | 3-bromo-5-nitrobenzene-1,2-diamine |
| InChIKey | ZMIPOEDYIVSXNT-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1N)N)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)