CAS 69404-94-0 is the registry number for Methoxy-4-(((1,1-dimethylethyl)dimethylsilyl)oxy)-3-benzaldehyde. Offered by: TRC. Available pack sizes: 10g.
4-[tert-butyl(dimethyl)silyl]oxy-3-methoxybenzaldehyde (CAS 69404-94-0) is a chemical compound with the molecular formula C14H22O3Si and a molecular weight of 266.41 g/mol. IUPAC name: 4-[tert-butyl(dimethyl)silyl]oxy-3-methoxybenzaldehyde. InChIKey: UBTYFBWZRXUZFF-UHFFFAOYSA-N.
| Molecular formula | C14H22O3Si |
|---|---|
| Molecular weight | 266.41 g/mol |
| IUPAC name | 4-[tert-butyl(dimethyl)silyl]oxy-3-methoxybenzaldehyde |
| InChIKey | UBTYFBWZRXUZFF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OC1=C(C=C(C=C1)C=O)OC |
Computed by PubChem (NCBI)