CAS 97315-18-9 is the registry number for 3-tert-Butyldimethylsiloxy-4-methoxybenzaldehyde. Offered by: TRC. Available pack sizes: 1g, 2g, 500mg.
3-[tert-butyl(dimethyl)silyl]oxy-4-methoxybenzaldehyde (CAS 97315-18-9) is a chemical compound with the molecular formula C14H22O3Si and a molecular weight of 266.41 g/mol. IUPAC name: 3-[tert-butyl(dimethyl)silyl]oxy-4-methoxybenzaldehyde. InChIKey: RYTUEPCRTPXDLU-UHFFFAOYSA-N.
| Molecular formula | C14H22O3Si |
|---|---|
| Molecular weight | 266.41 g/mol |
| IUPAC name | 3-[tert-butyl(dimethyl)silyl]oxy-4-methoxybenzaldehyde |
| InChIKey | RYTUEPCRTPXDLU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OC1=C(C=CC(=C1)C=O)OC |
Computed by PubChem (NCBI)