Products 6941-12-4
CAS 6941-12-4 is the registry number for 2-(4-tert-Butylphenoxy)propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2-(4-tert-butylphenoxy)propanoic acid (CAS 6941-12-4) is a chemical compound with the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. IUPAC name: 2-(4-tert-butylphenoxy)propanoic acid. InChIKey: DMJZZNRMJJGRNF-UHFFFAOYSA-N.
| Molecular formula | C13H18O3 |
|---|---|
| Molecular weight | 222.28 g/mol |
| IUPAC name | 2-(4-tert-butylphenoxy)propanoic acid |
| InChIKey | DMJZZNRMJJGRNF-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)OC1=CC=C(C=C1)C(C)(C)C |
Computed by PubChem (NCBI)
Synonyms:
2-(4-tert-butylphenoxy)propanoic acid, 2-[4-(tert-butyl)phenoxy]propanoic acid, 2-(4-(tert-Butyl)phenoxy)propanoic acid, Oprea1_776356, DMJZZNRMJJGRNF-UHFFFAOYSA-N, 2-(p-tert-Butylphenoxy)propionic acid, Propanoic acid,1-dimethylethyl)phenoxy]-, alpha-(p-tert-Butylphenoxy)propionic acid, Propionic acid, 2-(p-tert-butylphenoxy)-, 4-tert-Butylphenoxy-.alpha.-propionic acid