CAS 69429-84-1 is the registry number for Cilobamine (free base). Offered by: TargetMol. Available pack sizes: 25mg, 50mg, 100mg.
(2R,3R)-2-(3,4-dichlorophenyl)-3-(propan-2-ylamino)bicyclo[2.2.2]octan-2-ol (CAS 69429-84-1) is a chemical compound with the molecular formula C17H23Cl2NO and a molecular weight of 328.3 g/mol. IUPAC name: (2R,3R)-2-(3,4-dichlorophenyl)-3-(propan-2-ylamino)bicyclo[2.2.2]octan-2-ol. InChIKey: MQILJMOEUMZBHK-FIMMUYGNSA-N.
| Molecular formula | C17H23Cl2NO |
|---|---|
| Molecular weight | 328.3 g/mol |
| IUPAC name | (2R,3R)-2-(3,4-dichlorophenyl)-3-(propan-2-ylamino)bicyclo[2.2.2]octan-2-ol |
| InChIKey | MQILJMOEUMZBHK-FIMMUYGNSA-N |
| SMILES | CC(C)N[C@@H]1C2CCC([C@]1(C3=CC(=C(C=C3)Cl)Cl)O)CC2 |
Computed by PubChem (NCBI)