CAS 69433-18-7 is the registry number for Benzyl 2-amino-2-thioxoacetate, 95%. Offered by: AmBeed. Available pack sizes: 1g.
Benzyl 2-amino-2-sulfanylideneacetate (CAS 69433-18-7) is a chemical compound with the molecular formula C9H9NO2S and a molecular weight of 195.24 g/mol. IUPAC name: benzyl 2-amino-2-sulfanylideneacetate. InChIKey: IYJRARALPXEPHN-UHFFFAOYSA-N.
| Molecular formula | C9H9NO2S |
|---|---|
| Molecular weight | 195.24 g/mol |
| IUPAC name | benzyl 2-amino-2-sulfanylideneacetate |
| InChIKey | IYJRARALPXEPHN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)C(=S)N |
Computed by PubChem (NCBI)