CAS 69501-56-0 is the registry number for (R)-2-Amino-2-(p-tolyl)acetic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
(2R)-2-amino-2-(4-methylphenyl)acetic acid (CAS 69501-56-0) is a chemical compound with the molecular formula C9H11NO2 and a molecular weight of 165.19 g/mol. IUPAC name: (2R)-2-amino-2-(4-methylphenyl)acetic acid. InChIKey: RZRRCPHBUKHOEY-MRVPVSSYSA-N.
| Molecular formula | C9H11NO2 |
|---|---|
| Molecular weight | 165.19 g/mol |
| IUPAC name | (2R)-2-amino-2-(4-methylphenyl)acetic acid |
| InChIKey | RZRRCPHBUKHOEY-MRVPVSSYSA-N |
| SMILES | CC1=CC=C(C=C1)[C@H](C(=O)O)N |
Computed by PubChem (NCBI)