Products 69502-33-6

CAS 69502-33-6 is the registry number for Toluene-4-sulfonic acid 2-(2-[2-(tetrahydro-pyran-2-yloxy)-ethoxy]-ethoxy)-ethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-[2-[2-(oxan-2-yloxy)ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate (CAS 69502-33-6) is a chemical compound with the molecular formula C18H28O7S and a molecular weight of 388.5 g/mol. IUPAC name: 2-[2-[2-(oxan-2-yloxy)ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate. InChIKey: IUELZZOCOJFXRF-UHFFFAOYSA-N.

Identity
Molecular formulaC18H28O7S
Molecular weight388.5 g/mol
IUPAC name2-[2-[2-(oxan-2-yloxy)ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate
InChIKeyIUELZZOCOJFXRF-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)S(=O)(=O)OCCOCCOCCOC2CCCCO2

Computed by PubChem (NCBI)