CAS 850090-13-0 appears in our catalog under these names: Tos-peg3-t-butyl ester, 95%, Tos–PEG2–C2–Boc, Tos-PEG2-C2-Boc 95%, Tos-PEG3-t-butyl ester, 98%, 98%, Tos-PEG2-C2-Boc, 98.51%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 5g, 250mg, 1g, 100mg, 500mg, 10g, 25g, 5 g.
Tert-butyl 3-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]propanoate (CAS 850090-13-0) is a chemical compound with the molecular formula C18H28O7S and a molecular weight of 388.5 g/mol. IUPAC name: tert-butyl 3-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]propanoate. InChIKey: ATHTXRBMNTZSMB-UHFFFAOYSA-N.
| Molecular formula | C18H28O7S |
|---|---|
| Molecular weight | 388.5 g/mol |
| IUPAC name | tert-butyl 3-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]propanoate |
| InChIKey | ATHTXRBMNTZSMB-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCOCCOCCC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)