Products 6953-30-6

CAS 6953-30-6 is the registry number for 1-Methyl-3-phenethylurea, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.

Structural formula: {0} (CAS {1})

1-methyl-3-(2-phenylethyl)urea (CAS 6953-30-6) is a chemical compound with the molecular formula C10H14N2O and a molecular weight of 178.23 g/mol. IUPAC name: 1-methyl-3-(2-phenylethyl)urea. InChIKey: YCLJQUVEVLDQHI-UHFFFAOYSA-N.

Identity
Molecular formulaC10H14N2O
Molecular weight178.23 g/mol
IUPAC name1-methyl-3-(2-phenylethyl)urea
InChIKeyYCLJQUVEVLDQHI-UHFFFAOYSA-N
SMILESCNC(=O)NCCC1=CC=CC=C1

Computed by PubChem (NCBI)