CAS 69654-89-3 appears in our catalog under these names: FA-Gly-Leu-OH, FA–Gly–Leu–OH. Offered by: Creative Peptides, GLPBio, Biosynth. Available pack sizes: on request, 1g, 250mg, 500mg, 1000mg.
(2S)-2-[[2-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]acetyl]amino]-4-methylpentanoic acid (CAS 69654-89-3) is a chemical compound with the molecular formula C15H20N2O5 and a molecular weight of 308.33 g/mol. IUPAC name: (2S)-2-[[2-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]acetyl]amino]-4-methylpentanoic acid. InChIKey: OBFWNISOMLCYSX-FYJFLYSWSA-N.
| Molecular formula | C15H20N2O5 |
|---|---|
| Molecular weight | 308.33 g/mol |
| IUPAC name | (2S)-2-[[2-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]acetyl]amino]-4-methylpentanoic acid |
| InChIKey | OBFWNISOMLCYSX-FYJFLYSWSA-N |
| SMILES | CC(C)C[C@@H](C(=O)O)NC(=O)CNC(=O)/C=C/C1=CC=CO1 |
Computed by PubChem (NCBI)