CAS 696657-58-6 is the registry number for 5,5-Dimethyl-3-(3H-2,3,5-triazolylamino)cyclohex-2-en-1-one. Offered by: Biosynth. Available pack sizes: 5000mg.
5,5-dimethyl-3-(1H-1,2,4-triazol-5-ylamino)cyclohex-2-en-1-one (CAS 696657-58-6) is a chemical compound with the molecular formula C10H14N4O and a molecular weight of 206.24 g/mol. IUPAC name: 5,5-dimethyl-3-(1H-1,2,4-triazol-5-ylamino)cyclohex-2-en-1-one. InChIKey: BGXYNMYHIFRMBV-UHFFFAOYSA-N.
| Molecular formula | C10H14N4O |
|---|---|
| Molecular weight | 206.24 g/mol |
| IUPAC name | 5,5-dimethyl-3-(1H-1,2,4-triazol-5-ylamino)cyclohex-2-en-1-one |
| InChIKey | BGXYNMYHIFRMBV-UHFFFAOYSA-N |
| SMILES | CC1(CC(=CC(=O)C1)NC2=NC=NN2)C |
Computed by PubChem (NCBI)