CAS 6975-73-1 appears in our catalog under these names: 4–(hydrazinecarbonyl)pyridin–1–ium–1–olate, Topiroxostat Impurity 1, Topiroxostat Impurity 3. Offered by: GLPBio, Chemat Brand. Available pack sizes: 1g, on request.
1-oxidopyridin-1-ium-4-carbohydrazide (CAS 6975-73-1) is a chemical compound with the molecular formula C6H7N3O2 and a molecular weight of 153.14 g/mol. IUPAC name: 1-oxidopyridin-1-ium-4-carbohydrazide. InChIKey: XKGCDQMJYCDBPE-UHFFFAOYSA-N.
| Molecular formula | C6H7N3O2 |
|---|---|
| Molecular weight | 153.14 g/mol |
| IUPAC name | 1-oxidopyridin-1-ium-4-carbohydrazide |
| InChIKey | XKGCDQMJYCDBPE-UHFFFAOYSA-N |
| SMILES | C1=C[N+](=CC=C1C(=O)NN)[O-] |
Computed by PubChem (NCBI)