CAS 698357-45-8 is the registry number for 2-(2-(2’,6’-Dichloro-4’-hydroxphenylamino)phenyl)-N,N-dimethylacetamide. Offered by: TRC. Available pack sizes: 10mg, 2mg, 5mg.
2-[2-(2,6-dichloro-4-hydroxyanilino)phenyl]-N,N-dimethylacetamide (CAS 698357-45-8) is a chemical compound with the molecular formula C16H16Cl2N2O2 and a molecular weight of 339.2 g/mol. IUPAC name: 2-[2-(2,6-dichloro-4-hydroxyanilino)phenyl]-N,N-dimethylacetamide. InChIKey: PHEVCOKHWYKTOS-UHFFFAOYSA-N.
| Molecular formula | C16H16Cl2N2O2 |
|---|---|
| Molecular weight | 339.2 g/mol |
| IUPAC name | 2-[2-(2,6-dichloro-4-hydroxyanilino)phenyl]-N,N-dimethylacetamide |
| InChIKey | PHEVCOKHWYKTOS-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)CC1=CC=CC=C1NC2=C(C=C(C=C2Cl)O)Cl |
Computed by PubChem (NCBI)