CAS 72854-51-4 is the registry number for 2-Amino-N-(2-benzoyl-4-chlorophenyl)-N-methylacetamide Hydrochloride. Offered by: TRC. Available pack sizes: 100mg, 10mg, 50mg.
2-amino-N-(2-benzoyl-4-chlorophenyl)-N-methylacetamide;hydrochloride (CAS 72854-51-4) is a chemical compound with the molecular formula C16H16Cl2N2O2 and a molecular weight of 339.2 g/mol. IUPAC name: 2-amino-N-(2-benzoyl-4-chlorophenyl)-N-methylacetamide;hydrochloride. InChIKey: GALMFSMHOIZOPK-UHFFFAOYSA-N.
| Molecular formula | C16H16Cl2N2O2 |
|---|---|
| Molecular weight | 339.2 g/mol |
| IUPAC name | 2-amino-N-(2-benzoyl-4-chlorophenyl)-N-methylacetamide;hydrochloride |
| InChIKey | GALMFSMHOIZOPK-UHFFFAOYSA-N |
| SMILES | CN(C1=C(C=C(C=C1)Cl)C(=O)C2=CC=CC=C2)C(=O)CN.Cl |
Computed by PubChem (NCBI)