Products 69891-38-9
CAS 69891-38-9 appears in our catalog under these names: N–Cinnamoyl–N–(2，3–xylyl)hydroxylamine, N-Cinnamoyl-N-(2,3-xylyl)hydroxylamine, >98.0%(HPLC)(N), N-(2,3-Dimethylphenyl)-N-hydroxycinnamamide 98%, N-(2,3-Dimethylphenyl)-N-hydroxycinnamamide, 98%, 98%, N-Cinnamoyl-N-(2,3-xylyl)hydroxylamine, 98%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 200mg, 5g, 250mg, 100mg.
N-(2,3-dimethylphenyl)-N-hydroxy-3-phenylprop-2-enamide (CAS 69891-38-9) is a chemical compound with the molecular formula C17H17NO2 and a molecular weight of 267.32 g/mol. IUPAC name: N-(2,3-dimethylphenyl)-N-hydroxy-3-phenylprop-2-enamide. InChIKey: SLIQYZYALKWWAT-UHFFFAOYSA-N.
| Molecular formula | C17H17NO2 |
|---|---|
| Molecular weight | 267.32 g/mol |
| IUPAC name | N-(2,3-dimethylphenyl)-N-hydroxy-3-phenylprop-2-enamide |
| InChIKey | SLIQYZYALKWWAT-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)N(C(=O)C=CC2=CC=CC=C2)O)C |
Computed by PubChem (NCBI)